C19H28ClN3O4 — CID 87814417
(2S,3S)-3-[(2R)-2-(3-chlorophenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 87814417) has the molecular formula C19H28ClN3O4 and a molecular weight of 397.90 g/mol. Its IUPAC name is (2S,3S)-3-[(2R)-2-(3-chlorophenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (2S,3S)-3-[(2R)-2-(3-chlorophenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 87814417 |
| Molecular Formula | C19H28ClN3O4 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (2S,3S)-3-[(2R)-2-(3-chlorophenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | CC(C)C[C@H](C(=O)N1CCNC[C@@]1(C)c1cccc(Cl)c1)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C19H28ClN3O4/c1-12(2)9-15(16(24)17(25)22-27)18(26)23-8-7-21-11-19(23,3)13-5-4-6-14(20)10-13/h4-6,10,12,15-16,21,24,27H,7-9,11H2,1-3H3,(H,22,25)/t15-,16-,19-/m0/s1 |
| InChIKey | NXJVDYFSRPFFAZ-BXWFABGCSA-N |
| XLogP | 1.52 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|