C36H47N5O4Pb — CID 87814520
CID 87814520 (PubChem CID 87814520) has the molecular formula C36H47N5O4Pb and a molecular weight of 821.00 g/mol.
| Compound Name | CID 87814520 |
|---|---|
| PubChem CID | 87814520 |
| Molecular Formula | C36H47N5O4Pb |
| Molecular Weight | 821.00 g/mol |
| Exact Mass | 821.34 |
| IUPAC Name | — |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CN(Cc2cccnc2)CCN1C[C@@H](O)C[C@@H](Cc1ccccc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O.[Pb] |
| InChI | InChI=1S/C36H47N5O4.Pb/c1-36(2,3)39-35(45)31-24-40(22-26-12-9-15-37-21-26)16-17-41(31)23-29(42)19-28(18-25-10-5-4-6-11-25)34(44)38-33-30-14-8-7-13-27(30)20-32(33)43;/h4-15,21,28-29,31-33,42-43H,16-20,22-24H2,1-3H3,(H,38,44)(H,39,45);/t28-,29+,31+,32-,33+;/m1./s1 |
| InChIKey | AAHFTRFKQPNJQW-BDEHJDMKSA-N |
| XLogP | 2.49 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.00 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |