C21H34N4O4 — CID 87814537
(2S,3S)-3-[(2R)-2-[4-(dimethylamino)phenyl]-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 87814537) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is (2S,3S)-3-[(2R)-2-[4-(dimethylamino)phenyl]-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (2S,3S)-3-[(2R)-2-[4-(dimethylamino)phenyl]-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 87814537 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (2S,3S)-3-[(2R)-2-[4-(dimethylamino)phenyl]-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | CC(C)C[C@H](C(=O)N1CCNC[C@@]1(C)c1ccc(N(C)C)cc1)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C21H34N4O4/c1-14(2)12-17(18(26)19(27)23-29)20(28)25-11-10-22-13-21(25,3)15-6-8-16(9-7-15)24(4)5/h6-9,14,17-18,22,26,29H,10-13H2,1-5H3,(H,23,27)/t17-,18-,21-/m0/s1 |
| InChIKey | NPFRGOJKFSMGJI-WFXMLNOXSA-N |
| XLogP | 0.93 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|