C8H15BrN2O3 — CID 87814645
methyl (2S)-2-[(3-amino-2-bromo-2-methyl-3-oxopropyl)amino]propanoate (PubChem CID 87814645) has the molecular formula C8H15BrN2O3 and a molecular weight of 267.12 g/mol. Its IUPAC name is methyl (2S)-2-[(3-amino-2-bromo-2-methyl-3-oxopropyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(3-amino-2-bromo-2-methyl-3-oxopropyl)amino]propanoate |
|---|---|
| PubChem CID | 87814645 |
| Molecular Formula | C8H15BrN2O3 |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | methyl (2S)-2-[(3-amino-2-bromo-2-methyl-3-oxopropyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NCC(C)(Br)C(N)=O |
| InChI | InChI=1S/C8H15BrN2O3/c1-5(6(12)14-3)11-4-8(2,9)7(10)13/h5,11H,4H2,1-3H3,(H2,10,13)/t5-,8?/m0/s1 |
| InChIKey | HLPFBMBOKFQWSC-NTFOPCPOSA-N |
| XLogP | -0.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|