About 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid
1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid (PubChem CID 87814892) has the molecular formula C9H10N2O4S2
and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 87814892 |
| Molecular Formula | C9H10N2O4S2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C1N[C@H](C(=O)O)CS1.On1ccccc1=S |
| InChI | InChI=1S/C5H5NOS.C4H5NO3S/c7-6-4-2-1-3-5(6)8;6-3(7)2-1-9-4(8)5-2/h1-4,7H;2H,1H2,(H,5,8)(H,6,7)/t;2-/m.0/s1 |
| InChIKey | SSUKUXLTEWVKJZ-WNQIDUERSA-N |
| XLogP | 1.35 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid (CID 87814892) is 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid is O=C1N[C@H](C(=O)O)CS1.On1ccccc1=S.
What is the InChIKey of 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is SSUKUXLTEWVKJZ-WNQIDUERSA-N. The full InChI is InChI=1S/C5H5NOS.C4H5NO3S/c7-6-4-2-1-3-5(6)8;6-3(7)2-1-9-4(8)5-2/h1-4,7H;2H,1H2,(H,5,8)(H,6,7)/t;2-/m.0/s1.
What are the key properties of 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid?
1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 274.32 g/mol, XLogP of 1.35, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypyridine-2-thione;(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 87814892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).