About 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile
2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 87814902) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 87814902 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | CCC(C=O)CCCn1ncnc1C#N |
| InChI | InChI=1S/C10H14N4O/c1-2-9(7-15)4-3-5-14-10(6-11)12-8-13-14/h7-9H,2-5H2,1H3 |
| InChIKey | MZJZNFNVEHYABP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile (CID 87814902) is 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile is CCC(C=O)CCCn1ncnc1C#N.
What is the InChIKey of 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile?
The InChIKey is MZJZNFNVEHYABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c1-2-9(7-15)4-3-5-14-10(6-11)12-8-13-14/h7-9H,2-5H2,1H3.
What are the key properties of 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile?
2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile has a molecular weight of 206.25 g/mol, XLogP of 1.16, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-formylhexyl)-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 87814902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).