C28H28N4O2S — CID 87814924
3-benzyl-5-(cyclohexylmethyl)-1-(4-nitrophenyl)-1,3,4-benzotriazepine-2-thione (PubChem CID 87814924) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is 3-benzyl-5-(cyclohexylmethyl)-1-(4-nitrophenyl)-1,3,4-benzotriazepine-2-thione.
| Compound Name | 3-benzyl-5-(cyclohexylmethyl)-1-(4-nitrophenyl)-1,3,4-benzotriazepine-2-thione |
|---|---|
| PubChem CID | 87814924 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 3-benzyl-5-(cyclohexylmethyl)-1-(4-nitrophenyl)-1,3,4-benzotriazepine-2-thione |
| SMILES | O=[N+]([O-])c1ccc(N2C(=S)N(Cc3ccccc3)N=C(CC3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H28N4O2S/c33-32(34)24-17-15-23(16-18-24)31-27-14-8-7-13-25(27)26(19-21-9-3-1-4-10-21)29-30(28(31)35)20-22-11-5-2-6-12-22/h2,5-8,11-18,21H,1,3-4,9-10,19-20H2 |
| InChIKey | RYTGERYTJVQLBQ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|