C9H18O6 — CID 87814999
(2R,3R,4S,5S)-7-methyloct-6-ene-1,2,3,4,5,6-hexol (PubChem CID 87814999) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2R,3R,4S,5S)-7-methyloct-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4S,5S)-7-methyloct-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 87814999 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2R,3R,4S,5S)-7-methyloct-6-ene-1,2,3,4,5,6-hexol |
| SMILES | CC(C)=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O6/c1-4(2)6(12)8(14)9(15)7(13)5(11)3-10/h5,7-15H,3H2,1-2H3/t5-,7-,8-,9+/m1/s1 |
| InChIKey | XZJCJVQSAGTQSR-YYNOVJQHSA-N |
| XLogP | -1.73 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|