C23H20ClN3O2S — CID 87815078
5-[[9-[(4-aminophenyl)methyl]carbazol-4-yl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 87815078) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is 5-[[9-[(4-aminophenyl)methyl]carbazol-4-yl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-[[9-[(4-aminophenyl)methyl]carbazol-4-yl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 87815078 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 5-[[9-[(4-aminophenyl)methyl]carbazol-4-yl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.Nc1ccc(Cn2c3ccccc3c3c(CC4SC(=O)NC4=O)cccc32)cc1 |
| InChI | InChI=1S/C23H19N3O2S.ClH/c24-16-10-8-14(9-11-16)13-26-18-6-2-1-5-17(18)21-15(4-3-7-19(21)26)12-20-22(27)25-23(28)29-20;/h1-11,20H,12-13,24H2,(H,25,27,28);1H |
| InChIKey | NMOQDWWRWMKPKM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|