C28H44O3 — CID 87815790
cis-(1R,3R)-5-[2-[(1R,7aS)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-1-hydroxy-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 87815790) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is cis-(1R,3R)-5-[2-[(1R,7aS)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-1-hydroxy-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | cis-(1R,3R)-5-[2-[(1R,7aS)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-1-hydroxy-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 87815790 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | cis-(1R,3R)-5-[2-[(1R,7aS)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-1-hydroxy-7a-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@@]3(C)C2CC[C@@]3(O)[C@H](C)C=C[C@H](C)C(C)C)C[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C28H44O3/c1-18(2)19(3)9-10-20(4)28(31)15-13-25-22(8-7-14-27(25,28)6)11-12-23-16-24(29)17-26(30)21(23)5/h9-12,18-20,24-26,29-31H,5,7-8,13-17H2,1-4,6H3/t19-,20+,24+,25?,26+,27-,28+/m0/s1 |
| InChIKey | KKPCUEIDGSCZMQ-PITFYVHRSA-N |
| XLogP | 5.73 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|