About 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate
2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate (PubChem CID 87815815) has the molecular formula C19H34O3
and a molecular weight of 310.48 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate.
Molecular Properties
| Compound Name | 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate |
| PubChem CID | 87815815 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate |
| SMILES | CC(C)C1CCC(CC(C)(C)C(=O)OC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H34O3/c1-13(2)15-10-8-14(9-11-15)12-19(6,7)17(21)22-16(20)18(3,4)5/h13-15H,8-12H2,1-7H3 |
| InChIKey | ULJTXGTXAYXWQR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate?
The IUPAC name of 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate (CID 87815815) is 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate.
What is the SMILES notation for 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate?
The canonical SMILES for 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate is CC(C)C1CCC(CC(C)(C)C(=O)OC(=O)C(C)(C)C)CC1.
What is the InChIKey of 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate?
The InChIKey is ULJTXGTXAYXWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O3/c1-13(2)15-10-8-14(9-11-15)12-19(6,7)17(21)22-16(20)18(3,4)5/h13-15H,8-12H2,1-7H3.
What are the key properties of 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate?
2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate has a molecular weight of 310.48 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanoyl 2,2-dimethyl-3-(4-propan-2-ylcyclohexyl)propanoate is sourced from PubChem (CID 87815815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).