C13H11N3O5 — CID 87816588
N-hydroxy-4-oxospiro[6H-pyrimido[2,1-c][1,4]oxazepine-10,4'-pyran]-2-carboxamide (PubChem CID 87816588) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-hydroxy-4-oxospiro[6H-pyrimido[2,1-c][1,4]oxazepine-10,4'-pyran]-2-carboxamide.
| Compound Name | N-hydroxy-4-oxospiro[6H-pyrimido[2,1-c][1,4]oxazepine-10,4'-pyran]-2-carboxamide |
|---|---|
| PubChem CID | 87816588 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-hydroxy-4-oxospiro[6H-pyrimido[2,1-c][1,4]oxazepine-10,4'-pyran]-2-carboxamide |
| SMILES | O=C(NO)c1cc(=O)n2c(n1)C1(C=COC=C1)OC=CC2 |
| InChI | InChI=1S/C13H11N3O5/c17-10-8-9(11(18)15-19)14-12-13(2-6-20-7-3-13)21-5-1-4-16(10)12/h1-3,5-8,19H,4H2,(H,15,18) |
| InChIKey | CNLWXWXRQASBBR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|