C11H11N3O4 — CID 87816929
N-hydroxy-4'-oxospiro[cyclobutane-1,9'-pyrimido[2,1-c][1,4]oxazine]-2'-carboxamide (PubChem CID 87816929) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is N-hydroxy-4'-oxospiro[cyclobutane-1,9'-pyrimido[2,1-c][1,4]oxazine]-2'-carboxamide.
| Compound Name | N-hydroxy-4'-oxospiro[cyclobutane-1,9'-pyrimido[2,1-c][1,4]oxazine]-2'-carboxamide |
|---|---|
| PubChem CID | 87816929 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-hydroxy-4'-oxospiro[cyclobutane-1,9'-pyrimido[2,1-c][1,4]oxazine]-2'-carboxamide |
| SMILES | O=C(NO)c1cc(=O)n2c(n1)C1(CCC1)OC=C2 |
| InChI | InChI=1S/C11H11N3O4/c15-8-6-7(9(16)13-17)12-10-11(2-1-3-11)18-5-4-14(8)10/h4-6,17H,1-3H2,(H,13,16) |
| InChIKey | PGIFXZGZCPUKGS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|