C20H19AsN3O5S — CID 87817671
CID 87817671 (PubChem CID 87817671) has the molecular formula C20H19AsN3O5S and a molecular weight of 488.38 g/mol.
| Compound Name | CID 87817671 |
|---|---|
| PubChem CID | 87817671 |
| Molecular Formula | C20H19AsN3O5S |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1cc(C#N)c(N2CC(C(=O)[As]S(=O)(=O)c3ccccc3)C2)nc1C |
| InChI | InChI=1S/C20H19AsN3O5S/c1-3-29-20(26)17-9-14(10-22)19(23-13(17)2)24-11-15(12-24)18(25)21-30(27,28)16-7-5-4-6-8-16/h4-9,15H,3,11-12H2,1-2H3 |
| InChIKey | AEYXJGNAADUZFC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 117.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|