C14H14Cl4O4 — CID 87817981
dipropan-2-yl 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate (PubChem CID 87817981) has the molecular formula C14H14Cl4O4 and a molecular weight of 388.07 g/mol. Its IUPAC name is dipropan-2-yl 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87817981 |
| Molecular Formula | C14H14Cl4O4 |
| Molecular Weight | 388.07 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | dipropan-2-yl 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)OC(C)C |
| InChI | InChI=1S/C14H14Cl4O4/c1-5(2)21-13(19)7-8(14(20)22-6(3)4)10(16)12(18)11(17)9(7)15/h5-6H,1-4H3 |
| InChIKey | OGUXNWYOZFCMFO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.07 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|