C47H70N2 — CID 87817995
[3-dec-1-ynyl-2-(3,4,5-tributylphenyl)-5-(3,4,5-tripropylphenyl)pyrrol-1-ium-1-ylidene]azanide (PubChem CID 87817995) has the molecular formula C47H70N2 and a molecular weight of 663.09 g/mol. Its IUPAC name is [3-dec-1-ynyl-2-(3,4,5-tributylphenyl)-5-(3,4,5-tripropylphenyl)pyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [3-dec-1-ynyl-2-(3,4,5-tributylphenyl)-5-(3,4,5-tripropylphenyl)pyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87817995 |
| Molecular Formula | C47H70N2 |
| Molecular Weight | 663.09 g/mol |
| Exact Mass | 662.55 |
| IUPAC Name | [3-dec-1-ynyl-2-(3,4,5-tributylphenyl)-5-(3,4,5-tripropylphenyl)pyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCCCC#CC1=C(c2cc(CCCC)c(CCCC)c(CCCC)c2)[N+](=[N-])C(c2cc(CCC)c(CCC)c(CCC)c2)=C1 |
| InChI | InChI=1S/C47H70N2/c1-8-15-19-20-21-22-23-24-30-41-36-46(42-32-37(25-12-5)44(27-14-7)38(33-42)26-13-6)49(48)47(41)43-34-39(28-16-9-2)45(31-18-11-4)40(35-43)29-17-10-3/h32-36H,8-23,25-29,31H2,1-7H3 |
| InChIKey | RVFBXABZWKTONU-UHFFFAOYSA-N |
| XLogP | 14.13 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.09 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|