C36H30N4Pt — CID 87818680
2,3,7,8,12,13,17,18-octakis(ethenyl)-21,22-dihydroporphyrin;platinum (PubChem CID 87818680) has the molecular formula C36H30N4Pt and a molecular weight of 713.74 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octakis(ethenyl)-21,22-dihydroporphyrin;platinum.
| Compound Name | 2,3,7,8,12,13,17,18-octakis(ethenyl)-21,22-dihydroporphyrin;platinum |
|---|---|
| PubChem CID | 87818680 |
| Molecular Formula | C36H30N4Pt |
| Molecular Weight | 713.74 g/mol |
| Exact Mass | 713.21 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octakis(ethenyl)-21,22-dihydroporphyrin;platinum |
| SMILES | C=CC1=C(C=C)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(C=C)=C5C=C)c(C=C)c4C=C)c(C=C)c3C=C.[Pt] |
| InChI | InChI=1S/C36H30N4.Pt/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h9-20,37-38H,1-8H2;/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-; |
| InChIKey | KFQCGENXQZEZHK-XTPDIVBZSA-N |
| XLogP | 9.45 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.74 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |