C17H22F3N3O5 — CID 87818979
(2S)-N,2-dihydroxy-3-methyl-N-[(2R)-2-methyl-2-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-4-oxobutanamide (PubChem CID 87818979) has the molecular formula C17H22F3N3O5 and a molecular weight of 405.37 g/mol. Its IUPAC name is (2S)-N,2-dihydroxy-3-methyl-N-[(2R)-2-methyl-2-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-4-oxobutanamide.
| Compound Name | (2S)-N,2-dihydroxy-3-methyl-N-[(2R)-2-methyl-2-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 87818979 |
| Molecular Formula | C17H22F3N3O5 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (2S)-N,2-dihydroxy-3-methyl-N-[(2R)-2-methyl-2-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]-4-oxobutanamide |
| SMILES | CC(C=O)[C@H](O)C(=O)N(O)N1CCNC[C@@]1(C)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3N3O5/c1-11(9-24)14(25)15(26)23(27)22-8-7-21-10-16(22,2)12-3-5-13(6-4-12)28-17(18,19)20/h3-6,9,11,14,21,25,27H,7-8,10H2,1-2H3/t11?,14-,16-/m0/s1 |
| InChIKey | IBMRROHPVQQHNT-VYIWWYPRSA-N |
| XLogP | 1.03 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|