C40H60N2 — CID 87819081
[2-(3,4,5-triethylphenyl)-5-(3,4,5-trihexylphenyl)pyrrol-1-ium-1-ylidene]azanide (PubChem CID 87819081) has the molecular formula C40H60N2 and a molecular weight of 568.93 g/mol. Its IUPAC name is [2-(3,4,5-triethylphenyl)-5-(3,4,5-trihexylphenyl)pyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [2-(3,4,5-triethylphenyl)-5-(3,4,5-trihexylphenyl)pyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87819081 |
| Molecular Formula | C40H60N2 |
| Molecular Weight | 568.93 g/mol |
| Exact Mass | 568.48 |
| IUPAC Name | [2-(3,4,5-triethylphenyl)-5-(3,4,5-trihexylphenyl)pyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCc1cc(C2=CC=C(c3cc(CC)c(CC)c(CC)c3)[N+]2=[N-])cc(CCCCCC)c1CCCCCC |
| InChI | InChI=1S/C40H60N2/c1-7-13-16-19-22-33-29-36(30-34(23-20-17-14-8-2)38(33)24-21-18-15-9-3)40-26-25-39(42(40)41)35-27-31(10-4)37(12-6)32(11-5)28-35/h25-30H,7-24H2,1-6H3 |
| InChIKey | HMUUJEKSPFTURD-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.93 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|