C33H46N2Ni — CID 87819830
[3-butyl-2-(3-octylphenyl)-5-(4-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide;nickel (PubChem CID 87819830) has the molecular formula C33H46N2Ni and a molecular weight of 529.44 g/mol. Its IUPAC name is [3-butyl-2-(3-octylphenyl)-5-(4-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide;nickel.
| Compound Name | [3-butyl-2-(3-octylphenyl)-5-(4-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide;nickel |
|---|---|
| PubChem CID | 87819830 |
| Molecular Formula | C33H46N2Ni |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | [3-butyl-2-(3-octylphenyl)-5-(4-pentylphenyl)pyrrol-1-ium-1-ylidene]azanide;nickel |
| SMILES | CCCCCCCCc1cccc(C2=C(CCCC)C=C(c3ccc(CCCCC)cc3)[N+]2=[N-])c1.[Ni] |
| InChI | InChI=1S/C33H46N2.Ni/c1-4-7-10-11-12-14-17-28-18-15-20-30(25-28)33-31(19-9-6-3)26-32(35(33)34)29-23-21-27(22-24-29)16-13-8-5-2;/h15,18,20-26H,4-14,16-17,19H2,1-3H3; |
| InChIKey | IUWKCYCZTXVXRZ-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|