C46H66N2 — CID 87820696
[2,5-bis(2-hept-3-enylphenyl)-3-pentyl-4-undec-1-enylpyrrol-1-ium-1-ylidene]azanide (PubChem CID 87820696) has the molecular formula C46H66N2 and a molecular weight of 647.05 g/mol. Its IUPAC name is [2,5-bis(2-hept-3-enylphenyl)-3-pentyl-4-undec-1-enylpyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [2,5-bis(2-hept-3-enylphenyl)-3-pentyl-4-undec-1-enylpyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87820696 |
| Molecular Formula | C46H66N2 |
| Molecular Weight | 647.05 g/mol |
| Exact Mass | 646.52 |
| IUPAC Name | [2,5-bis(2-hept-3-enylphenyl)-3-pentyl-4-undec-1-enylpyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCC=CCCc1ccccc1C1=C(C=CCCCCCCCCC)C(CCCCC)=C(c2ccccc2CCC=CCCC)[N+]1=[N-] |
| InChI | InChI=1S/C46H66N2/c1-5-9-13-16-17-18-19-22-26-38-44-43(37-23-12-8-4)45(41-35-29-27-33-39(41)31-24-20-14-10-6-2)48(47)46(44)42-36-30-28-34-40(42)32-25-21-15-11-7-3/h14-15,20-21,26-30,33-36,38H,5-13,16-19,22-25,31-32,37H2,1-4H3 |
| InChIKey | RUBGTBWDYFVLHM-UHFFFAOYSA-N |
| XLogP | 14.71 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.05 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|