C22H19FN2O5S — CID 87821054
5-[[4-[[4-fluoro-3-(2-hydroxypropan-2-yl)phenyl]methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87821054) has the molecular formula C22H19FN2O5S and a molecular weight of 442.47 g/mol. Its IUPAC name is 5-[[4-[[4-fluoro-3-(2-hydroxypropan-2-yl)phenyl]methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[4-fluoro-3-(2-hydroxypropan-2-yl)phenyl]methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87821054 |
| Molecular Formula | C22H19FN2O5S |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 5-[[4-[[4-fluoro-3-(2-hydroxypropan-2-yl)phenyl]methyl]-3-oxo-1,4-benzoxazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)(O)c1cc(CN2C(=O)COc3ccc(C=C4SC(=O)NC4=O)cc32)ccc1F |
| InChI | InChI=1S/C22H19FN2O5S/c1-22(2,29)14-7-13(3-5-15(14)23)10-25-16-8-12(4-6-17(16)30-11-19(25)26)9-18-20(27)24-21(28)31-18/h3-9,29H,10-11H2,1-2H3,(H,24,27,28) |
| InChIKey | CAZIRYQJXUBOGA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|