C25H30O5 — CID 87821108
ethyl 2-[3-[1-(4a,5-dihydronaphthalen-2-yl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]propanoate (PubChem CID 87821108) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is ethyl 2-[3-[1-(4a,5-dihydronaphthalen-2-yl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]propanoate.
| Compound Name | ethyl 2-[3-[1-(4a,5-dihydronaphthalen-2-yl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]propanoate |
|---|---|
| PubChem CID | 87821108 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | ethyl 2-[3-[1-(4a,5-dihydronaphthalen-2-yl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]propanoate |
| SMILES | C=C(C1=CC2=CC=CCC2C=C1)C1COC2(CCC(=C(C)C(=O)OCC)CC2)OO1 |
| InChI | InChI=1S/C25H30O5/c1-4-27-24(26)18(3)19-11-13-25(14-12-19)28-16-23(29-30-25)17(2)21-10-9-20-7-5-6-8-22(20)15-21/h5-6,8-10,15,20,23H,2,4,7,11-14,16H2,1,3H3/b19-18- |
| InChIKey | SFXKOOQPBXBSEX-HNENSFHCSA-N |
| XLogP | 5.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|