C14H14Cl7FO — CID 87822379
1-fluoro-1-methoxypropane;1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 87822379) has the molecular formula C14H14Cl7FO and a molecular weight of 465.43 g/mol. Its IUPAC name is 1-fluoro-1-methoxypropane;1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 1-fluoro-1-methoxypropane;1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 87822379 |
| Molecular Formula | C14H14Cl7FO |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 461.88 |
| IUPAC Name | 1-fluoro-1-methoxypropane;1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | CCC(F)OC.ClC1=C(Cl)C2(Cl)C3C(Cl)C=CC3C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H5Cl7.C4H9FO/c11-4-2-1-3-5(4)9(15)7(13)6(12)8(3,14)10(9,16)17;1-3-4(5)6-2/h1-5H;4H,3H2,1-2H3 |
| InChIKey | MITFHOYKUOEXJZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|