C21H16Cl2N2O3S2 — CID 87822516
(2S)-4-[2-(3,4-dichlorophenyl)ethyl]-2-methyl-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-3-one (PubChem CID 87822516) has the molecular formula C21H16Cl2N2O3S2 and a molecular weight of 479.41 g/mol. Its IUPAC name is (2S)-4-[2-(3,4-dichlorophenyl)ethyl]-2-methyl-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-3-one.
| Compound Name | (2S)-4-[2-(3,4-dichlorophenyl)ethyl]-2-methyl-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 87822516 |
| Molecular Formula | C21H16Cl2N2O3S2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | (2S)-4-[2-(3,4-dichlorophenyl)ethyl]-2-methyl-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1Oc2ccc(C=C3SC(=S)NC3=O)cc2N(CCc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C21H16Cl2N2O3S2/c1-11-20(27)25(7-6-12-2-4-14(22)15(23)8-12)16-9-13(3-5-17(16)28-11)10-18-19(26)24-21(29)30-18/h2-5,8-11H,6-7H2,1H3,(H,24,26,29)/t11-/m0/s1 |
| InChIKey | ACKRXTMFBJKTLO-NSHDSACASA-N |
| XLogP | 4.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|