C44H68I2N2Ni — CID 87823072
[3-butyl-2,5-bis(3,4,5-tributylphenyl)pyrrol-1-ium-1-ylidene]azanide;diiodonickel (PubChem CID 87823072) has the molecular formula C44H68I2N2Ni and a molecular weight of 937.54 g/mol. Its IUPAC name is [3-butyl-2,5-bis(3,4,5-tributylphenyl)pyrrol-1-ium-1-ylidene]azanide;diiodonickel.
| Compound Name | [3-butyl-2,5-bis(3,4,5-tributylphenyl)pyrrol-1-ium-1-ylidene]azanide;diiodonickel |
|---|---|
| PubChem CID | 87823072 |
| Molecular Formula | C44H68I2N2Ni |
| Molecular Weight | 937.54 g/mol |
| Exact Mass | 936.28 |
| IUPAC Name | [3-butyl-2,5-bis(3,4,5-tributylphenyl)pyrrol-1-ium-1-ylidene]azanide;diiodonickel |
| SMILES | CCCCC1=C(c2cc(CCCC)c(CCCC)c(CCCC)c2)[N+](=[N-])C(c2cc(CCCC)c(CCCC)c(CCCC)c2)=C1.I[Ni]I |
| InChI | InChI=1S/C44H68N2.2HI.Ni/c1-8-15-22-34-29-39(30-35(23-16-9-2)41(34)27-20-13-6)43-33-38(26-19-12-5)44(46(43)45)40-31-36(24-17-10-3)42(28-21-14-7)37(32-40)25-18-11-4;;;/h29-33H,8-28H2,1-7H3;2*1H;/q;;;+2/p-2 |
| InChIKey | FTFMORZLRANMIK-UHFFFAOYSA-L |
| XLogP | 15.50 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.54 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|