About 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide
2,2,2-tris(dimethylamino)-N,N-dimethylacetamide (PubChem CID 87823120) has the molecular formula C10H24N4O
and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide |
| PubChem CID | 87823120 |
| Molecular Formula | C10H24N4O |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C(N(C)C)(N(C)C)N(C)C |
| InChI | InChI=1S/C10H24N4O/c1-11(2)9(15)10(12(3)4,13(5)6)14(7)8/h1-8H3 |
| InChIKey | LCDHKAWCKNXUSP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide?
The IUPAC name of 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide (CID 87823120) is 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide.
What is the SMILES notation for 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide?
The canonical SMILES for 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide is CN(C)C(=O)C(N(C)C)(N(C)C)N(C)C.
What is the InChIKey of 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide?
The InChIKey is LCDHKAWCKNXUSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N4O/c1-11(2)9(15)10(12(3)4,13(5)6)14(7)8/h1-8H3.
What are the key properties of 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide?
2,2,2-tris(dimethylamino)-N,N-dimethylacetamide has a molecular weight of 216.33 g/mol, XLogP of -0.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-tris(dimethylamino)-N,N-dimethylacetamide is sourced from PubChem (CID 87823120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).