About 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea
1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 87823763) has the molecular formula C15H19N5OS
and a molecular weight of 317.42 g/mol. Its IUPAC name is 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 87823763 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | N[C@H]1CCCN(NC(=O)Nc2ncc(-c3ccccc3)s2)C1 |
| InChI | InChI=1S/C15H19N5OS/c16-12-7-4-8-20(10-12)19-14(21)18-15-17-9-13(22-15)11-5-2-1-3-6-11/h1-3,5-6,9,12H,4,7-8,10,16H2,(H2,17,18,19,21)/t12-/m0/s1 |
| InChIKey | QCKOADSFWMOHNY-LBPRGKRZSA-N |
| XLogP | 2.27 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea (CID 87823763) is 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea is N[C@H]1CCCN(NC(=O)Nc2ncc(-c3ccccc3)s2)C1.
What is the InChIKey of 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea?
The InChIKey is QCKOADSFWMOHNY-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H19N5OS/c16-12-7-4-8-20(10-12)19-14(21)18-15-17-9-13(22-15)11-5-2-1-3-6-11/h1-3,5-6,9,12H,4,7-8,10,16H2,(H2,17,18,19,21)/t12-/m0/s1.
What are the key properties of 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea?
1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea has a molecular weight of 317.42 g/mol, XLogP of 2.27, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3-aminopiperidin-1-yl]-3-(5-phenyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 87823763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).