C10H15F7O2 — CID 87823826
(6,7,7,8,8,8-hexafluoro-5-hydroxy-2,2-dimethyloctan-3-yl) hypofluorite (PubChem CID 87823826) has the molecular formula C10H15F7O2 and a molecular weight of 300.21 g/mol. Its IUPAC name is (6,7,7,8,8,8-hexafluoro-5-hydroxy-2,2-dimethyloctan-3-yl) hypofluorite.
| Compound Name | (6,7,7,8,8,8-hexafluoro-5-hydroxy-2,2-dimethyloctan-3-yl) hypofluorite |
|---|---|
| PubChem CID | 87823826 |
| Molecular Formula | C10H15F7O2 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (6,7,7,8,8,8-hexafluoro-5-hydroxy-2,2-dimethyloctan-3-yl) hypofluorite |
| SMILES | CC(C)(C)C(CC(O)C(F)C(F)(F)C(F)(F)F)OF |
| InChI | InChI=1S/C10H15F7O2/c1-8(2,3)6(19-17)4-5(18)7(11)9(12,13)10(14,15)16/h5-7,18H,4H2,1-3H3 |
| InChIKey | FQADZQBRAWPLCN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|