About 2,6-ditert-butyl-3,4-dimethylbenzenethiol
2,6-ditert-butyl-3,4-dimethylbenzenethiol (PubChem CID 87823915) has the molecular formula C16H26S
and a molecular weight of 250.45 g/mol. Its IUPAC name is 2,6-ditert-butyl-3,4-dimethylbenzenethiol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-3,4-dimethylbenzenethiol |
| PubChem CID | 87823915 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2,6-ditert-butyl-3,4-dimethylbenzenethiol |
| SMILES | Cc1cc(C(C)(C)C)c(S)c(C(C)(C)C)c1C |
| InChI | InChI=1S/C16H26S/c1-10-9-12(15(3,4)5)14(17)13(11(10)2)16(6,7)8/h9,17H,1-8H3 |
| InChIKey | OLMRJPRJCQSHCD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,6-ditert-butyl-3,4-dimethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-3,4-dimethylbenzenethiol?
The IUPAC name of 2,6-ditert-butyl-3,4-dimethylbenzenethiol (CID 87823915) is 2,6-ditert-butyl-3,4-dimethylbenzenethiol.
What is the SMILES notation for 2,6-ditert-butyl-3,4-dimethylbenzenethiol?
The canonical SMILES for 2,6-ditert-butyl-3,4-dimethylbenzenethiol is Cc1cc(C(C)(C)C)c(S)c(C(C)(C)C)c1C.
What is the InChIKey of 2,6-ditert-butyl-3,4-dimethylbenzenethiol?
The InChIKey is OLMRJPRJCQSHCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26S/c1-10-9-12(15(3,4)5)14(17)13(11(10)2)16(6,7)8/h9,17H,1-8H3.
What are the key properties of 2,6-ditert-butyl-3,4-dimethylbenzenethiol?
2,6-ditert-butyl-3,4-dimethylbenzenethiol has a molecular weight of 250.45 g/mol, XLogP of 5.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-3,4-dimethylbenzenethiol is sourced from PubChem (CID 87823915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).