C27H41F6NO2Si — CID 87823967
2-[cyclopropylmethyl-[4-(1,1,1,3,3,3-hexafluoro-2-triethylsilyloxypropan-2-yl)cyclohexyl]amino]-1-phenylethanol (PubChem CID 87823967) has the molecular formula C27H41F6NO2Si and a molecular weight of 553.70 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[4-(1,1,1,3,3,3-hexafluoro-2-triethylsilyloxypropan-2-yl)cyclohexyl]amino]-1-phenylethanol.
| Compound Name | 2-[cyclopropylmethyl-[4-(1,1,1,3,3,3-hexafluoro-2-triethylsilyloxypropan-2-yl)cyclohexyl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 87823967 |
| Molecular Formula | C27H41F6NO2Si |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 2-[cyclopropylmethyl-[4-(1,1,1,3,3,3-hexafluoro-2-triethylsilyloxypropan-2-yl)cyclohexyl]amino]-1-phenylethanol |
| SMILES | CC[Si](CC)(CC)OC(C1CCC(N(CC2CC2)CC(O)c2ccccc2)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H41F6NO2Si/c1-4-37(5-2,6-3)36-25(26(28,29)30,27(31,32)33)22-14-16-23(17-15-22)34(18-20-12-13-20)19-24(35)21-10-8-7-9-11-21/h7-11,20,22-24,35H,4-6,12-19H2,1-3H3 |
| InChIKey | WUAMYTDEIRNOOM-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|