About propane-1,1,1-tricarboxamide
propane-1,1,1-tricarboxamide (PubChem CID 87824043) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is propane-1,1,1-tricarboxamide.
Molecular Properties
| Compound Name | propane-1,1,1-tricarboxamide |
| PubChem CID | 87824043 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | propane-1,1,1-tricarboxamide |
| SMILES | CCC(C(N)=O)(C(N)=O)C(N)=O |
| InChI | InChI=1S/C6H11N3O3/c1-2-6(3(7)10,4(8)11)5(9)12/h2H2,1H3,(H2,7,10)(H2,8,11)(H2,9,12) |
| InChIKey | TVTYHZLXPFUGOO-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propane-1,1,1-tricarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,1,1-tricarboxamide?
The IUPAC name of propane-1,1,1-tricarboxamide (CID 87824043) is propane-1,1,1-tricarboxamide.
What is the SMILES notation for propane-1,1,1-tricarboxamide?
The canonical SMILES for propane-1,1,1-tricarboxamide is CCC(C(N)=O)(C(N)=O)C(N)=O.
What is the InChIKey of propane-1,1,1-tricarboxamide?
The InChIKey is TVTYHZLXPFUGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O3/c1-2-6(3(7)10,4(8)11)5(9)12/h2H2,1H3,(H2,7,10)(H2,8,11)(H2,9,12).
What are the key properties of propane-1,1,1-tricarboxamide?
propane-1,1,1-tricarboxamide has a molecular weight of 173.17 g/mol, XLogP of -2.16, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,1,1-tricarboxamide is sourced from PubChem (CID 87824043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).