About 1,7-dihydroxy-3,5-dimethylideneheptan-4-one
1,7-dihydroxy-3,5-dimethylideneheptan-4-one (PubChem CID 87824269) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1,7-dihydroxy-3,5-dimethylideneheptan-4-one.
Molecular Properties
| Compound Name | 1,7-dihydroxy-3,5-dimethylideneheptan-4-one |
| PubChem CID | 87824269 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1,7-dihydroxy-3,5-dimethylideneheptan-4-one |
| SMILES | C=C(CCO)C(=O)C(=C)CCO |
| InChI | InChI=1S/C9H14O3/c1-7(3-5-10)9(12)8(2)4-6-11/h10-11H,1-6H2 |
| InChIKey | BKHSPWFCLHZTRF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,7-dihydroxy-3,5-dimethylideneheptan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dihydroxy-3,5-dimethylideneheptan-4-one?
The IUPAC name of 1,7-dihydroxy-3,5-dimethylideneheptan-4-one (CID 87824269) is 1,7-dihydroxy-3,5-dimethylideneheptan-4-one.
What is the SMILES notation for 1,7-dihydroxy-3,5-dimethylideneheptan-4-one?
The canonical SMILES for 1,7-dihydroxy-3,5-dimethylideneheptan-4-one is C=C(CCO)C(=O)C(=C)CCO.
What is the InChIKey of 1,7-dihydroxy-3,5-dimethylideneheptan-4-one?
The InChIKey is BKHSPWFCLHZTRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-7(3-5-10)9(12)8(2)4-6-11/h10-11H,1-6H2.
What are the key properties of 1,7-dihydroxy-3,5-dimethylideneheptan-4-one?
1,7-dihydroxy-3,5-dimethylideneheptan-4-one has a molecular weight of 170.21 g/mol, XLogP of 0.43, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dihydroxy-3,5-dimethylideneheptan-4-one is sourced from PubChem (CID 87824269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).