C28H29FeN3-6 — CID 87824441
N-cyclopenta-2,4-dien-1-yl-1-[6-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]-2-pyridinyl]ethanimine;cyclopentane;iron (PubChem CID 87824441) has the molecular formula C28H29FeN3-6 and a molecular weight of 463.41 g/mol. Its IUPAC name is N-cyclopenta-2,4-dien-1-yl-1-[6-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]-2-pyridinyl]ethanimine;cyclopentane;iron.
| Compound Name | N-cyclopenta-2,4-dien-1-yl-1-[6-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]-2-pyridinyl]ethanimine;cyclopentane;iron |
|---|---|
| PubChem CID | 87824441 |
| Molecular Formula | C28H29FeN3-6 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-cyclopenta-2,4-dien-1-yl-1-[6-[C-methyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]-2-pyridinyl]ethanimine;cyclopentane;iron |
| SMILES | C/C(=N\c1c(C)cc(C)cc1C)c1cccc(/C(C)=N/[c-]2cccc2)n1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C23H24N3.C5H5.Fe/c1-15-13-16(2)23(17(3)14-15)25-19(5)22-12-8-11-21(26-22)18(4)24-20-9-6-7-10-20;1-2-4-5-3-1;/h6-14H,1-5H3;1-5H;/q-1;-5;/b24-18+,25-19+;; |
| InChIKey | UPOKLWDGSVAUJW-AJJNMWGASA-N |
| XLogP | 7.41 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|