About (E)-2-octyldec-2-enoic acid
(E)-2-octyldec-2-enoic acid (PubChem CID 87824483) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is (E)-2-octyldec-2-enoic acid.
Molecular Properties
| Compound Name | (E)-2-octyldec-2-enoic acid |
| PubChem CID | 87824483 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (E)-2-octyldec-2-enoic acid |
| SMILES | CCCCCCC/C=C(\CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C18H34O2/c1-3-5-7-9-11-13-15-17(18(19)20)16-14-12-10-8-6-4-2/h15H,3-14,16H2,1-2H3,(H,19,20)/b17-15+ |
| InChIKey | IDCAKUIEBJEUIQ-BMRADRMJSA-N |
| XLogP | 6.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-octyldec-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-octyldec-2-enoic acid?
The IUPAC name of (E)-2-octyldec-2-enoic acid (CID 87824483) is (E)-2-octyldec-2-enoic acid.
What is the SMILES notation for (E)-2-octyldec-2-enoic acid?
The canonical SMILES for (E)-2-octyldec-2-enoic acid is CCCCCCC/C=C(\CCCCCCCC)C(=O)O.
What is the InChIKey of (E)-2-octyldec-2-enoic acid?
The InChIKey is IDCAKUIEBJEUIQ-BMRADRMJSA-N. The full InChI is InChI=1S/C18H34O2/c1-3-5-7-9-11-13-15-17(18(19)20)16-14-12-10-8-6-4-2/h15H,3-14,16H2,1-2H3,(H,19,20)/b17-15+.
What are the key properties of (E)-2-octyldec-2-enoic acid?
(E)-2-octyldec-2-enoic acid has a molecular weight of 282.47 g/mol, XLogP of 6.11, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-octyldec-2-enoic acid is sourced from PubChem (CID 87824483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).