C28H33F3N6O2S — CID 87824509
cis-(1R,2S)-N-[cyano(cyclopropyl)methyl]-2-[4-[2-(piperidin-4-ylamino)-1,3-thiazol-4-yl]-N-(2,2,2-trifluoroacetyl)anilino]cyclohexane-1-carboxamide (PubChem CID 87824509) has the molecular formula C28H33F3N6O2S and a molecular weight of 574.67 g/mol. Its IUPAC name is cis-(1R,2S)-N-[cyano(cyclopropyl)methyl]-2-[4-[2-(piperidin-4-ylamino)-1,3-thiazol-4-yl]-N-(2,2,2-trifluoroacetyl)anilino]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[cyano(cyclopropyl)methyl]-2-[4-[2-(piperidin-4-ylamino)-1,3-thiazol-4-yl]-N-(2,2,2-trifluoroacetyl)anilino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87824509 |
| Molecular Formula | C28H33F3N6O2S |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | cis-(1R,2S)-N-[cyano(cyclopropyl)methyl]-2-[4-[2-(piperidin-4-ylamino)-1,3-thiazol-4-yl]-N-(2,2,2-trifluoroacetyl)anilino]cyclohexane-1-carboxamide |
| SMILES | N#CC(NC(=O)[C@@H]1CCCC[C@@H]1N(C(=O)C(F)(F)F)c1ccc(-c2csc(NC3CCNCC3)n2)cc1)C1CC1 |
| InChI | InChI=1S/C28H33F3N6O2S/c29-28(30,31)26(39)37(24-4-2-1-3-21(24)25(38)35-22(15-32)17-5-6-17)20-9-7-18(8-10-20)23-16-40-27(36-23)34-19-11-13-33-14-12-19/h7-10,16-17,19,21-22,24,33H,1-6,11-14H2,(H,34,36)(H,35,38)/t21-,22?,24+/m1/s1 |
| InChIKey | DQLGCTLQJYBIPC-FTPWCCPUSA-N |
| XLogP | 4.85 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |