About bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+)
bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+) (PubChem CID 87824831) has the molecular formula C44H54Cl2Zr
and a molecular weight of 745.05 g/mol. Its IUPAC name is bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+).
Molecular Properties
| Compound Name | bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+) |
| PubChem CID | 87824831 |
| Molecular Formula | C44H54Cl2Zr |
| Molecular Weight | 745.05 g/mol |
| Exact Mass | 742.26 |
| IUPAC Name | bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+) |
| SMILES | Cc1cc(C(C)(C)C)[c-]c2c1-c1ccc(C(C)(C)C)cc1C2.Cc1cc(C(C)(C)C)[c-]c2c1-c1ccc(C(C)(C)C)cc1C2.Cl[Zr+2]Cl |
| InChI | InChI=1S/2C22H27.2ClH.Zr/c2*1-14-10-18(22(5,6)7)13-16-11-15-12-17(21(2,3)4)8-9-19(15)20(14)16;;;/h2*8-10,12H,11H2,1-7H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | MLZAYWHIYFKYJC-UHFFFAOYSA-L |
| XLogP | 13.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 745.05 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+)?
The IUPAC name of bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+) (CID 87824831) is bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+).
What is the SMILES notation for bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+)?
The canonical SMILES for bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+) is Cc1cc(C(C)(C)C)[c-]c2c1-c1ccc(C(C)(C)C)cc1C2.Cc1cc(C(C)(C)C)[c-]c2c1-c1ccc(C(C)(C)C)cc1C2.Cl[Zr+2]Cl.
What is the InChIKey of bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+)?
The InChIKey is MLZAYWHIYFKYJC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C22H27.2ClH.Zr/c2*1-14-10-18(22(5,6)7)13-16-11-15-12-17(21(2,3)4)8-9-19(15)20(14)16;;;/h2*8-10,12H,11H2,1-7H3;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+)?
bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+) has a molecular weight of 745.05 g/mol, XLogP of 13.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,7-ditert-butyl-4-methyl-1,9-dihydrofluoren-1-ide);dichlorozirconium(2+) is sourced from PubChem (CID 87824831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).