About [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate
[2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate (PubChem CID 8782503) has the molecular formula C19H13F2N3O4
and a molecular weight of 385.33 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate.
Molecular Properties
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
| PubChem CID | 8782503 |
| Molecular Formula | C19H13F2N3O4 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)OCC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H13F2N3O4/c1-11-17(13(9-22)18(28-11)24-6-2-3-7-24)19(26)27-10-16(25)23-15-5-4-12(20)8-14(15)21/h2-8H,10H2,1H3,(H,23,25) |
| InChIKey | GEJKFXKILNGGFJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate?
The IUPAC name of [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate (CID 8782503) is [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate.
What is the SMILES notation for [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate?
The canonical SMILES for [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate is Cc1oc(-n2cccc2)c(C#N)c1C(=O)OCC(=O)Nc1ccc(F)cc1F.
What is the InChIKey of [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate?
The InChIKey is GEJKFXKILNGGFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2N3O4/c1-11-17(13(9-22)18(28-11)24-6-2-3-7-24)19(26)27-10-16(25)23-15-5-4-12(20)8-14(15)21/h2-8H,10H2,1H3,(H,23,25).
What are the key properties of [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate?
[2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate has a molecular weight of 385.33 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-difluoroanilino)-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate is sourced from PubChem (CID 8782503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).