C27H30ClN3O4 — CID 87825186
4-[8-chloro-5-cyclohexyl-7-methoxy-3-(oxan-4-yl)-2-oxo-1,3,4-benzotriazepin-1-yl]benzaldehyde (PubChem CID 87825186) has the molecular formula C27H30ClN3O4 and a molecular weight of 496.01 g/mol. Its IUPAC name is 4-[8-chloro-5-cyclohexyl-7-methoxy-3-(oxan-4-yl)-2-oxo-1,3,4-benzotriazepin-1-yl]benzaldehyde.
| Compound Name | 4-[8-chloro-5-cyclohexyl-7-methoxy-3-(oxan-4-yl)-2-oxo-1,3,4-benzotriazepin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 87825186 |
| Molecular Formula | C27H30ClN3O4 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-[8-chloro-5-cyclohexyl-7-methoxy-3-(oxan-4-yl)-2-oxo-1,3,4-benzotriazepin-1-yl]benzaldehyde |
| SMILES | COc1cc2c(cc1Cl)N(c1ccc(C=O)cc1)C(=O)N(C1CCOCC1)N=C2C1CCCCC1 |
| InChI | InChI=1S/C27H30ClN3O4/c1-34-25-15-22-24(16-23(25)28)30(20-9-7-18(17-32)8-10-20)27(33)31(21-11-13-35-14-12-21)29-26(22)19-5-3-2-4-6-19/h7-10,15-17,19,21H,2-6,11-14H2,1H3 |
| InChIKey | YCZODSFWPXYGMZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|