About 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene)
1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene) (PubChem CID 87825364) has the molecular formula C14H30O3
and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene).
Molecular Properties
| Compound Name | 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene) |
| PubChem CID | 87825364 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.COCC(C)OCC(C)OC |
| InChI | InChI=1S/C8H18O3.2C3H6/c1-7(10-4)6-11-8(2)5-9-3;2*1-3-2/h7-8H,5-6H2,1-4H3;2*3H,1H2,2H3 |
| InChIKey | YUDSADSMPQEFHZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene)?
The IUPAC name of 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene) (CID 87825364) is 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene).
What is the SMILES notation for 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene)?
The canonical SMILES for 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene) is C=CC.C=CC.COCC(C)OCC(C)OC.
What is the InChIKey of 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene)?
The InChIKey is YUDSADSMPQEFHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3.2C3H6/c1-7(10-4)6-11-8(2)5-9-3;2*1-3-2/h7-8H,5-6H2,1-4H3;2*3H,1H2,2H3.
What are the key properties of 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene)?
1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene) has a molecular weight of 246.39 g/mol, XLogP of 3.46, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-(2-methoxypropoxy)propane;bis(prop-1-ene) is sourced from PubChem (CID 87825364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).