C16H23ClN2O4 — CID 87825426
methyl 3-[6-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxy-2,2-dimethylpropanoate (PubChem CID 87825426) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is methyl 3-[6-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[6-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87825426 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | methyl 3-[6-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxy-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)C(O)c1ccc(Cl)nc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H23ClN2O4/c1-15(2,3)13(21)19-12-9(7-8-10(17)18-12)11(20)16(4,5)14(22)23-6/h7-8,11,20H,1-6H3,(H,18,19,21) |
| InChIKey | YUDRDERZLMTRJX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|