About 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde
6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde (PubChem CID 87825432) has the molecular formula C10H9Cl2NO
and a molecular weight of 230.09 g/mol. Its IUPAC name is 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde.
Molecular Properties
| Compound Name | 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde |
| PubChem CID | 87825432 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde |
| SMILES | O=CN1CCCc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C10H9Cl2NO/c11-8-4-7-2-1-3-13(6-14)10(7)9(12)5-8/h4-6H,1-3H2 |
| InChIKey | OGRLGENGPUYEID-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde?
The IUPAC name of 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde (CID 87825432) is 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde.
What is the SMILES notation for 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde?
The canonical SMILES for 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde is O=CN1CCCc2cc(Cl)cc(Cl)c21.
What is the InChIKey of 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde?
The InChIKey is OGRLGENGPUYEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO/c11-8-4-7-2-1-3-13(6-14)10(7)9(12)5-8/h4-6H,1-3H2.
What are the key properties of 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde?
6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde has a molecular weight of 230.09 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-3,4-dihydro-2H-quinoline-1-carbaldehyde is sourced from PubChem (CID 87825432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).