C6H11NO5 — CID 87826024
(4S)-2-[(1S)-1,2-dihydroxyethyl]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol (PubChem CID 87826024) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is (4S)-2-[(1S)-1,2-dihydroxyethyl]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol.
| Compound Name | (4S)-2-[(1S)-1,2-dihydroxyethyl]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol |
|---|---|
| PubChem CID | 87826024 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (4S)-2-[(1S)-1,2-dihydroxyethyl]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3,4-diol |
| SMILES | [O-][N+]1=C[C@H](O)C(O)C1[C@H](O)CO |
| InChI | InChI=1S/C6H11NO5/c8-2-4(10)5-6(11)3(9)1-7(5)12/h1,3-6,8-11H,2H2/t3-,4+,5?,6?/m0/s1 |
| InChIKey | OGXHYXTZRMJAOB-KKHOPBGESA-N |
| XLogP | -2.98 |
| TPSA | 106.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|