C12H10Cl4F5NO2S — CID 87826925
1,1,1,2,2-pentafluoroethane;2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 87826925) has the molecular formula C12H10Cl4F5NO2S and a molecular weight of 469.09 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoroethane;2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 1,1,1,2,2-pentafluoroethane;2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 87826925 |
| Molecular Formula | C12H10Cl4F5NO2S |
| Molecular Weight | 469.09 g/mol |
| Exact Mass | 466.91 |
| IUPAC Name | 1,1,1,2,2-pentafluoroethane;2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | FC(F)C(F)(F)F.O=C1C2CC=CCC2C(=O)N1SC(Cl)(Cl)C(Cl)Cl |
| InChI | InChI=1S/C10H9Cl4NO2S.C2HF5/c11-9(12)10(13,14)18-15-7(16)5-3-1-2-4-6(5)8(15)17;3-1(4)2(5,6)7/h1-2,5-6,9H,3-4H2;1H |
| InChIKey | KGNBAVPHCHWBLP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.09 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|