C28H29F6NO3 — CID 87827406
(2S)-2-[3,5-bis(trifluoromethyl)phenyl]-2-methyl-N-(8-phenyl-1,4-dioxaspiro[4.5]decan-8-yl)pent-4-enamide (PubChem CID 87827406) has the molecular formula C28H29F6NO3 and a molecular weight of 541.53 g/mol. Its IUPAC name is (2S)-2-[3,5-bis(trifluoromethyl)phenyl]-2-methyl-N-(8-phenyl-1,4-dioxaspiro[4.5]decan-8-yl)pent-4-enamide.
| Compound Name | (2S)-2-[3,5-bis(trifluoromethyl)phenyl]-2-methyl-N-(8-phenyl-1,4-dioxaspiro[4.5]decan-8-yl)pent-4-enamide |
|---|---|
| PubChem CID | 87827406 |
| Molecular Formula | C28H29F6NO3 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | (2S)-2-[3,5-bis(trifluoromethyl)phenyl]-2-methyl-N-(8-phenyl-1,4-dioxaspiro[4.5]decan-8-yl)pent-4-enamide |
| SMILES | C=CC[C@](C)(C(=O)NC1(c2ccccc2)CCC2(CC1)OCCO2)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H29F6NO3/c1-3-9-24(2,20-16-21(27(29,30)31)18-22(17-20)28(32,33)34)23(36)35-25(19-7-5-4-6-8-19)10-12-26(13-11-25)37-14-15-38-26/h3-8,16-18H,1,9-15H2,2H3,(H,35,36)/t24-/m0/s1 |
| InChIKey | ZJVDKAXDCGZGIO-DEOSSOPVSA-N |
| XLogP | 6.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|