C21H23ClFN3O5S2 — CID 87827556
[[(E)-2-(5-chlorothiophen-2-yl)ethenyl]sulfonyl-[1-[4-[1-(dimethylamino)ethyl]-2-fluorophenyl]-2-oxopyrrolidin-3-yl]amino] formate (PubChem CID 87827556) has the molecular formula C21H23ClFN3O5S2 and a molecular weight of 516.02 g/mol. Its IUPAC name is [[(E)-2-(5-chlorothiophen-2-yl)ethenyl]sulfonyl-[1-[4-[1-(dimethylamino)ethyl]-2-fluorophenyl]-2-oxopyrrolidin-3-yl]amino] formate.
| Compound Name | [[(E)-2-(5-chlorothiophen-2-yl)ethenyl]sulfonyl-[1-[4-[1-(dimethylamino)ethyl]-2-fluorophenyl]-2-oxopyrrolidin-3-yl]amino] formate |
|---|---|
| PubChem CID | 87827556 |
| Molecular Formula | C21H23ClFN3O5S2 |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | [[(E)-2-(5-chlorothiophen-2-yl)ethenyl]sulfonyl-[1-[4-[1-(dimethylamino)ethyl]-2-fluorophenyl]-2-oxopyrrolidin-3-yl]amino] formate |
| SMILES | CC(c1ccc(N2CCC(N(OC=O)S(=O)(=O)/C=C/c3ccc(Cl)s3)C2=O)c(F)c1)N(C)C |
| InChI | InChI=1S/C21H23ClFN3O5S2/c1-14(24(2)3)15-4-6-18(17(23)12-15)25-10-8-19(21(25)28)26(31-13-27)33(29,30)11-9-16-5-7-20(22)32-16/h4-7,9,11-14,19H,8,10H2,1-3H3/b11-9+ |
| InChIKey | GJDAYHMUYCIRMI-PKNBQFBNSA-N |
| XLogP | 3.66 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|