C20H27F2N3O6 — CID 87827997
(2S,3S)-3-[(2R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 87827997) has the molecular formula C20H27F2N3O6 and a molecular weight of 443.45 g/mol. Its IUPAC name is (2S,3S)-3-[(2R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (2S,3S)-3-[(2R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 87827997 |
| Molecular Formula | C20H27F2N3O6 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (2S,3S)-3-[(2R)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | CC(C)C[C@H](C(=O)N1CCNC[C@@]1(C)c1ccc2c(c1)OC(F)(F)O2)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C20H27F2N3O6/c1-11(2)8-13(16(26)17(27)24-29)18(28)25-7-6-23-10-19(25,3)12-4-5-14-15(9-12)31-20(21,22)30-14/h4-5,9,11,13,16,23,26,29H,6-8,10H2,1-3H3,(H,24,27)/t13-,16-,19-/m0/s1 |
| InChIKey | ZYEFIBZAHODEHW-AXHNFQJDSA-N |
| XLogP | 1.18 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|