C22H23ClN5O2S+ — CID 87828014
[(4S)-4-[4-(6-chloro-1,3-benzoxazol-2-yl)piperazin-1-yl]-3H-pyrrolizin-4-ium-2-yl]-(1,3-thiazolidin-3-yl)methanone (PubChem CID 87828014) has the molecular formula C22H23ClN5O2S+ and a molecular weight of 456.98 g/mol. Its IUPAC name is [(4S)-4-[4-(6-chloro-1,3-benzoxazol-2-yl)piperazin-1-yl]-3H-pyrrolizin-4-ium-2-yl]-(1,3-thiazolidin-3-yl)methanone.
| Compound Name | [(4S)-4-[4-(6-chloro-1,3-benzoxazol-2-yl)piperazin-1-yl]-3H-pyrrolizin-4-ium-2-yl]-(1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 87828014 |
| Molecular Formula | C22H23ClN5O2S+ |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [(4S)-4-[4-(6-chloro-1,3-benzoxazol-2-yl)piperazin-1-yl]-3H-pyrrolizin-4-ium-2-yl]-(1,3-thiazolidin-3-yl)methanone |
| SMILES | O=C(C1=CC2=CC=C[N@@+]2(N2CCN(c3nc4ccc(Cl)cc4o3)CC2)C1)N1CCSC1 |
| InChI | InChI=1S/C22H23ClN5O2S/c23-17-3-4-19-20(13-17)30-22(24-19)25-5-7-27(8-6-25)28-10-1-2-18(28)12-16(14-28)21(29)26-9-11-31-15-26/h1-4,10,12-13H,5-9,11,14-15H2/q+1/t28-/m1/s1 |
| InChIKey | PBJANKSXDOIMPL-MUUNZHRXSA-N |
| XLogP | 3.22 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|