C26H38N4O7 — CID 87828126
5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-2,3,4-trihydroxy-5-[(4-methyl-2-pyridinyl)amino]oxypentoxy]benzene-1,3-dicarboxamide (PubChem CID 87828126) has the molecular formula C26H38N4O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is 5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-2,3,4-trihydroxy-5-[(4-methyl-2-pyridinyl)amino]oxypentoxy]benzene-1,3-dicarboxamide.
| Compound Name | 5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-2,3,4-trihydroxy-5-[(4-methyl-2-pyridinyl)amino]oxypentoxy]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87828126 |
| Molecular Formula | C26H38N4O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 5-methyl-3-N,3-N-dipropyl-1-N-[(2S,3R)-2,3,4-trihydroxy-5-[(4-methyl-2-pyridinyl)amino]oxypentoxy]benzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)NOC[C@H](O)[C@H](O)C(O)CONc2cc(C)ccn2)c1 |
| InChI | InChI=1S/C26H38N4O7/c1-5-9-30(10-6-2)26(35)20-12-18(4)11-19(14-20)25(34)29-37-16-22(32)24(33)21(31)15-36-28-23-13-17(3)7-8-27-23/h7-8,11-14,21-22,24,31-33H,5-6,9-10,15-16H2,1-4H3,(H,27,28)(H,29,34)/t21?,22-,24+/m0/s1 |
| InChIKey | IQXMFVNJSUTPIR-ZBKSJXDOSA-N |
| XLogP | 1.75 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|