C16H21BF4N2O3S — CID 87828969
3-ethyl-5-methyl-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium tetrafluoroborate (PubChem CID 87828969) has the molecular formula C16H21BF4N2O3S and a molecular weight of 408.23 g/mol. Its IUPAC name is 3-ethyl-5-methyl-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium tetrafluoroborate.
| Compound Name | 3-ethyl-5-methyl-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium tetrafluoroborate |
|---|---|
| PubChem CID | 87828969 |
| Molecular Formula | C16H21BF4N2O3S |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-ethyl-5-methyl-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium tetrafluoroborate |
| SMILES | CC[n+]1nc(C)sc1/C=C/c1ccc(OC)c(OC)c1OC.F[B-](F)(F)F |
| InChI | InChI=1S/C16H21N2O3S.BF4/c1-6-18-14(22-11(2)17-18)10-8-12-7-9-13(19-3)16(21-5)15(12)20-4;2-1(3,4)5/h7-10H,6H2,1-5H3;/q+1;-1/b10-8+; |
| InChIKey | LNFKKSMHUDZQTG-VRTOBVRTSA-N |
| XLogP | 4.26 |
| TPSA | 44.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|